About sodium 3-cyano-2-methyl-5-(2,2,6-trimethylcyclohexyl)pentanoate
sodium 3-cyano-2-methyl-5-(2,2,6-trimethylcyclohexyl)pentanoate (PubChem CID 23693337) has the molecular formula C16H26NNaO2
and a molecular weight of 287.38 g/mol. Its IUPAC name is sodium 3-cyano-2-methyl-5-(2,2,6-trimethylcyclohexyl)pentanoate.
Molecular Properties
| Compound Name | sodium 3-cyano-2-methyl-5-(2,2,6-trimethylcyclohexyl)pentanoate |
| PubChem CID | 23693337 |
| Molecular Formula | C16H26NNaO2 |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | sodium 3-cyano-2-methyl-5-(2,2,6-trimethylcyclohexyl)pentanoate |
| SMILES | CC1CCCC(C)(C)C1CCC(C#N)C(C)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C16H27NO2.Na/c1-11-6-5-9-16(3,4)14(11)8-7-13(10-17)12(2)15(18)19;/h11-14H,5-9H2,1-4H3,(H,18,19);/q;+1/p-1 |
| InChIKey | MQHRFSXFSWYJHL-UHFFFAOYSA-M |
| XLogP | -0.24 |
| TPSA | 63.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium 3-cyano-2-methyl-5-(2,2,6-trimethylcyclohexyl)pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 3-cyano-2-methyl-5-(2,2,6-trimethylcyclohexyl)pentanoate?
The IUPAC name of sodium 3-cyano-2-methyl-5-(2,2,6-trimethylcyclohexyl)pentanoate (CID 23693337) is sodium 3-cyano-2-methyl-5-(2,2,6-trimethylcyclohexyl)pentanoate.
What is the SMILES notation for sodium 3-cyano-2-methyl-5-(2,2,6-trimethylcyclohexyl)pentanoate?
The canonical SMILES for sodium 3-cyano-2-methyl-5-(2,2,6-trimethylcyclohexyl)pentanoate is CC1CCCC(C)(C)C1CCC(C#N)C(C)C(=O)[O-].[Na+].
What is the InChIKey of sodium 3-cyano-2-methyl-5-(2,2,6-trimethylcyclohexyl)pentanoate?
The InChIKey is MQHRFSXFSWYJHL-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H27NO2.Na/c1-11-6-5-9-16(3,4)14(11)8-7-13(10-17)12(2)15(18)19;/h11-14H,5-9H2,1-4H3,(H,18,19);/q;+1/p-1.
What are the key properties of sodium 3-cyano-2-methyl-5-(2,2,6-trimethylcyclohexyl)pentanoate?
sodium 3-cyano-2-methyl-5-(2,2,6-trimethylcyclohexyl)pentanoate has a molecular weight of 287.38 g/mol, XLogP of -0.24, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-cyano-2-methyl-5-(2,2,6-trimethylcyclohexyl)pentanoate is sourced from PubChem (CID 23693337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).