About sodium 2-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamoyl]benzoate
sodium 2-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamoyl]benzoate (PubChem CID 23693349) has the molecular formula C17H12N3NaO5S2
and a molecular weight of 425.42 g/mol. Its IUPAC name is sodium 2-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamoyl]benzoate.
Molecular Properties
| Compound Name | sodium 2-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamoyl]benzoate |
| PubChem CID | 23693349 |
| Molecular Formula | C17H12N3NaO5S2 |
| Molecular Weight | 425.42 g/mol |
| Exact Mass | 425.01 |
| IUPAC Name | sodium 2-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamoyl]benzoate |
| SMILES | O=C([O-])c1ccccc1C(=O)Nc1ccc(S(=O)(=O)Nc2nccs2)cc1.[Na+] |
| InChI | InChI=1S/C17H13N3O5S2.Na/c21-15(13-3-1-2-4-14(13)16(22)23)19-11-5-7-12(8-6-11)27(24,25)20-17-18-9-10-26-17;/h1-10H,(H,18,20)(H,19,21)(H,22,23);/q;+1/p-1 |
| InChIKey | CWXDFUNTMRVKFA-UHFFFAOYSA-M |
| XLogP | -1.44 |
| TPSA | 128.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.42 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze sodium 2-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamoyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamoyl]benzoate?
The IUPAC name of sodium 2-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamoyl]benzoate (CID 23693349) is sodium 2-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamoyl]benzoate.
What is the SMILES notation for sodium 2-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamoyl]benzoate?
The canonical SMILES for sodium 2-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamoyl]benzoate is O=C([O-])c1ccccc1C(=O)Nc1ccc(S(=O)(=O)Nc2nccs2)cc1.[Na+].
What is the InChIKey of sodium 2-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamoyl]benzoate?
The InChIKey is CWXDFUNTMRVKFA-UHFFFAOYSA-M. The full InChI is InChI=1S/C17H13N3O5S2.Na/c21-15(13-3-1-2-4-14(13)16(22)23)19-11-5-7-12(8-6-11)27(24,25)20-17-18-9-10-26-17;/h1-10H,(H,18,20)(H,19,21)(H,22,23);/q;+1/p-1.
What are the key properties of sodium 2-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamoyl]benzoate?
sodium 2-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamoyl]benzoate has a molecular weight of 425.42 g/mol, XLogP of -1.44, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamoyl]benzoate is sourced from PubChem (CID 23693349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).