C19H22N5NaO7S — CID 23693654
sodium 4-[3-[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]propyl]benzenesulfonate (PubChem CID 23693654) has the molecular formula C19H22N5NaO7S and a molecular weight of 487.47 g/mol. Its IUPAC name is sodium 4-[3-[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]propyl]benzenesulfonate.
| Compound Name | sodium 4-[3-[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]propyl]benzenesulfonate |
|---|---|
| PubChem CID | 23693654 |
| Molecular Formula | C19H22N5NaO7S |
| Molecular Weight | 487.47 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | sodium 4-[3-[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]propyl]benzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccc(CCCNc2ncnc3c2ncn3[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)cc1.[Na+] |
| InChI | InChI=1S/C19H23N5O7S.Na/c25-8-13-15(26)16(27)19(31-13)24-10-23-14-17(21-9-22-18(14)24)20-7-1-2-11-3-5-12(6-4-11)32(28,29)30;/h3-6,9-10,13,15-16,19,25-27H,1-2,7-8H2,(H,20,21,22)(H,28,29,30);/q;+1/p-1/t13-,15-,16-,19-;/m1./s1 |
| InChIKey | YIYUNVYOOUQZRP-ZPXBPYQOSA-M |
| XLogP | -3.61 |
| TPSA | 182.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.47 |
| LogP ≤ 5 | -3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|