C33H37N4NaO6S2 — CID 23693680
sodium 2-[3-[[4-[2-(benzylcarbamoylsulfamoyl)phenyl]phenyl]methyl]-2-(1-hydroxyhexyl)-5-methylsulfanylimidazol-4-yl]acetate (PubChem CID 23693680) has the molecular formula C33H37N4NaO6S2 and a molecular weight of 672.81 g/mol. Its IUPAC name is sodium 2-[3-[[4-[2-(benzylcarbamoylsulfamoyl)phenyl]phenyl]methyl]-2-(1-hydroxyhexyl)-5-methylsulfanylimidazol-4-yl]acetate.
| Compound Name | sodium 2-[3-[[4-[2-(benzylcarbamoylsulfamoyl)phenyl]phenyl]methyl]-2-(1-hydroxyhexyl)-5-methylsulfanylimidazol-4-yl]acetate |
|---|---|
| PubChem CID | 23693680 |
| Molecular Formula | C33H37N4NaO6S2 |
| Molecular Weight | 672.81 g/mol |
| Exact Mass | 672.21 |
| IUPAC Name | sodium 2-[3-[[4-[2-(benzylcarbamoylsulfamoyl)phenyl]phenyl]methyl]-2-(1-hydroxyhexyl)-5-methylsulfanylimidazol-4-yl]acetate |
| SMILES | CCCCCC(O)c1nc(SC)c(CC(=O)[O-])n1Cc1ccc(-c2ccccc2S(=O)(=O)NC(=O)NCc2ccccc2)cc1.[Na+] |
| InChI | InChI=1S/C33H38N4O6S2.Na/c1-3-4-6-14-28(38)31-35-32(44-2)27(20-30(39)40)37(31)22-24-16-18-25(19-17-24)26-13-9-10-15-29(26)45(42,43)36-33(41)34-21-23-11-7-5-8-12-23;/h5,7-13,15-19,28,38H,3-4,6,14,20-22H2,1-2H3,(H,39,40)(H2,34,36,41);/q;+1/p-1 |
| InChIKey | IVVQHBQNBIBEOS-UHFFFAOYSA-M |
| XLogP | 1.42 |
| TPSA | 153.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.81 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|