About sodium 3-[4,5-bis(4-chlorophenyl)-4,5-dihydro-1H-imidazol-2-yl]benzoate
sodium 3-[4,5-bis(4-chlorophenyl)-4,5-dihydro-1H-imidazol-2-yl]benzoate (PubChem CID 23694730) has the molecular formula C22H15Cl2N2NaO2
and a molecular weight of 433.27 g/mol. Its IUPAC name is sodium 3-[4,5-bis(4-chlorophenyl)-4,5-dihydro-1H-imidazol-2-yl]benzoate.
Molecular Properties
| Compound Name | sodium 3-[4,5-bis(4-chlorophenyl)-4,5-dihydro-1H-imidazol-2-yl]benzoate |
| PubChem CID | 23694730 |
| Molecular Formula | C22H15Cl2N2NaO2 |
| Molecular Weight | 433.27 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | sodium 3-[4,5-bis(4-chlorophenyl)-4,5-dihydro-1H-imidazol-2-yl]benzoate |
| SMILES | O=C([O-])c1cccc(C2=NC(c3ccc(Cl)cc3)C(c3ccc(Cl)cc3)N2)c1.[Na+] |
| InChI | InChI=1S/C22H16Cl2N2O2.Na/c23-17-8-4-13(5-9-17)19-20(14-6-10-18(24)11-7-14)26-21(25-19)15-2-1-3-16(12-15)22(27)28;/h1-12,19-20H,(H,25,26)(H,27,28);/q;+1/p-1 |
| InChIKey | XVFAEZWTTYRIFI-UHFFFAOYSA-M |
| XLogP | 1.19 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.27 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze sodium 3-[4,5-bis(4-chlorophenyl)-4,5-dihydro-1H-imidazol-2-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 3-[4,5-bis(4-chlorophenyl)-4,5-dihydro-1H-imidazol-2-yl]benzoate?
The IUPAC name of sodium 3-[4,5-bis(4-chlorophenyl)-4,5-dihydro-1H-imidazol-2-yl]benzoate (CID 23694730) is sodium 3-[4,5-bis(4-chlorophenyl)-4,5-dihydro-1H-imidazol-2-yl]benzoate.
What is the SMILES notation for sodium 3-[4,5-bis(4-chlorophenyl)-4,5-dihydro-1H-imidazol-2-yl]benzoate?
The canonical SMILES for sodium 3-[4,5-bis(4-chlorophenyl)-4,5-dihydro-1H-imidazol-2-yl]benzoate is O=C([O-])c1cccc(C2=NC(c3ccc(Cl)cc3)C(c3ccc(Cl)cc3)N2)c1.[Na+].
What is the InChIKey of sodium 3-[4,5-bis(4-chlorophenyl)-4,5-dihydro-1H-imidazol-2-yl]benzoate?
The InChIKey is XVFAEZWTTYRIFI-UHFFFAOYSA-M. The full InChI is InChI=1S/C22H16Cl2N2O2.Na/c23-17-8-4-13(5-9-17)19-20(14-6-10-18(24)11-7-14)26-21(25-19)15-2-1-3-16(12-15)22(27)28;/h1-12,19-20H,(H,25,26)(H,27,28);/q;+1/p-1.
What are the key properties of sodium 3-[4,5-bis(4-chlorophenyl)-4,5-dihydro-1H-imidazol-2-yl]benzoate?
sodium 3-[4,5-bis(4-chlorophenyl)-4,5-dihydro-1H-imidazol-2-yl]benzoate has a molecular weight of 433.27 g/mol, XLogP of 1.19, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-[4,5-bis(4-chlorophenyl)-4,5-dihydro-1H-imidazol-2-yl]benzoate is sourced from PubChem (CID 23694730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).