About sodium 1-hydroxy-3,7-dimethyloct-6-ene-1-sulfonate
sodium 1-hydroxy-3,7-dimethyloct-6-ene-1-sulfonate (PubChem CID 23695312) has the molecular formula C10H19NaO4S
and a molecular weight of 258.31 g/mol. Its IUPAC name is sodium 1-hydroxy-3,7-dimethyloct-6-ene-1-sulfonate.
Molecular Properties
| Compound Name | sodium 1-hydroxy-3,7-dimethyloct-6-ene-1-sulfonate |
| PubChem CID | 23695312 |
| Molecular Formula | C10H19NaO4S |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | sodium 1-hydroxy-3,7-dimethyloct-6-ene-1-sulfonate |
| SMILES | CC(C)=CCCC(C)CC(O)S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C10H20O4S.Na/c1-8(2)5-4-6-9(3)7-10(11)15(12,13)14;/h5,9-11H,4,6-7H2,1-3H3,(H,12,13,14);/q;+1/p-1 |
| InChIKey | AOTGIENKPBLGMC-UHFFFAOYSA-M |
| XLogP | -1.37 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium 1-hydroxy-3,7-dimethyloct-6-ene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 1-hydroxy-3,7-dimethyloct-6-ene-1-sulfonate?
The IUPAC name of sodium 1-hydroxy-3,7-dimethyloct-6-ene-1-sulfonate (CID 23695312) is sodium 1-hydroxy-3,7-dimethyloct-6-ene-1-sulfonate.
What is the SMILES notation for sodium 1-hydroxy-3,7-dimethyloct-6-ene-1-sulfonate?
The canonical SMILES for sodium 1-hydroxy-3,7-dimethyloct-6-ene-1-sulfonate is CC(C)=CCCC(C)CC(O)S(=O)(=O)[O-].[Na+].
What is the InChIKey of sodium 1-hydroxy-3,7-dimethyloct-6-ene-1-sulfonate?
The InChIKey is AOTGIENKPBLGMC-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H20O4S.Na/c1-8(2)5-4-6-9(3)7-10(11)15(12,13)14;/h5,9-11H,4,6-7H2,1-3H3,(H,12,13,14);/q;+1/p-1.
What are the key properties of sodium 1-hydroxy-3,7-dimethyloct-6-ene-1-sulfonate?
sodium 1-hydroxy-3,7-dimethyloct-6-ene-1-sulfonate has a molecular weight of 258.31 g/mol, XLogP of -1.37, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 1-hydroxy-3,7-dimethyloct-6-ene-1-sulfonate is sourced from PubChem (CID 23695312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).