About sodium 1,4-bis(2-acetylhexoxy)-1,4-dioxobutane-2-sulfonate
sodium 1,4-bis(2-acetylhexoxy)-1,4-dioxobutane-2-sulfonate (PubChem CID 23695729) has the molecular formula C20H33NaO9S
and a molecular weight of 472.53 g/mol. Its IUPAC name is sodium 1,4-bis(2-acetylhexoxy)-1,4-dioxobutane-2-sulfonate.
Molecular Properties
| Compound Name | sodium 1,4-bis(2-acetylhexoxy)-1,4-dioxobutane-2-sulfonate |
| PubChem CID | 23695729 |
| Molecular Formula | C20H33NaO9S |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | sodium 1,4-bis(2-acetylhexoxy)-1,4-dioxobutane-2-sulfonate |
| SMILES | CCCCC(COC(=O)CC(C(=O)OCC(CCCC)C(C)=O)S(=O)(=O)[O-])C(C)=O.[Na+] |
| InChI | InChI=1S/C20H34O9S.Na/c1-5-7-9-16(14(3)21)12-28-19(23)11-18(30(25,26)27)20(24)29-13-17(15(4)22)10-8-6-2;/h16-18H,5-13H2,1-4H3,(H,25,26,27);/q;+1/p-1 |
| InChIKey | XQADZKVVIRETNG-UHFFFAOYSA-M |
| XLogP | -0.83 |
| TPSA | 143.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium 1,4-bis(2-acetylhexoxy)-1,4-dioxobutane-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 1,4-bis(2-acetylhexoxy)-1,4-dioxobutane-2-sulfonate?
The IUPAC name of sodium 1,4-bis(2-acetylhexoxy)-1,4-dioxobutane-2-sulfonate (CID 23695729) is sodium 1,4-bis(2-acetylhexoxy)-1,4-dioxobutane-2-sulfonate.
What is the SMILES notation for sodium 1,4-bis(2-acetylhexoxy)-1,4-dioxobutane-2-sulfonate?
The canonical SMILES for sodium 1,4-bis(2-acetylhexoxy)-1,4-dioxobutane-2-sulfonate is CCCCC(COC(=O)CC(C(=O)OCC(CCCC)C(C)=O)S(=O)(=O)[O-])C(C)=O.[Na+].
What is the InChIKey of sodium 1,4-bis(2-acetylhexoxy)-1,4-dioxobutane-2-sulfonate?
The InChIKey is XQADZKVVIRETNG-UHFFFAOYSA-M. The full InChI is InChI=1S/C20H34O9S.Na/c1-5-7-9-16(14(3)21)12-28-19(23)11-18(30(25,26)27)20(24)29-13-17(15(4)22)10-8-6-2;/h16-18H,5-13H2,1-4H3,(H,25,26,27);/q;+1/p-1.
What are the key properties of sodium 1,4-bis(2-acetylhexoxy)-1,4-dioxobutane-2-sulfonate?
sodium 1,4-bis(2-acetylhexoxy)-1,4-dioxobutane-2-sulfonate has a molecular weight of 472.53 g/mol, XLogP of -0.83, 16 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 1,4-bis(2-acetylhexoxy)-1,4-dioxobutane-2-sulfonate is sourced from PubChem (CID 23695729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).