About potassium;(4S)-4-amino-5-hydroxy-5-oxopentanoate;hydrate
potassium;(4S)-4-amino-5-hydroxy-5-oxopentanoate;hydrate (PubChem CID 23695977) has the molecular formula C5H10KNO5
and a molecular weight of 203.23 g/mol. Its IUPAC name is potassium;(4S)-4-amino-5-hydroxy-5-oxopentanoate;hydrate.
Molecular Properties
| Compound Name | potassium;(4S)-4-amino-5-hydroxy-5-oxopentanoate;hydrate |
| PubChem CID | 23695977 |
| Molecular Formula | C5H10KNO5 |
| Molecular Weight | 203.23 g/mol |
| Exact Mass | 203.02 |
| IUPAC Name | potassium;(4S)-4-amino-5-hydroxy-5-oxopentanoate;hydrate |
| SMILES | N[C@@H](CCC(=O)[O-])C(=O)O.O.[K+] |
| InChI | InChI=1S/C5H9NO4.K.H2O/c6-3(5(9)10)1-2-4(7)8;;/h3H,1-2,6H2,(H,7,8)(H,9,10);;1H2/q;+1;/p-1/t3-;;/m0../s1 |
| InChIKey | XIBUKSQTWSKJMQ-QTNFYWBSSA-M |
| XLogP | -5.89 |
| TPSA | 134.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.23 |
| LogP ≤ 5 | -5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze potassium;(4S)-4-amino-5-hydroxy-5-oxopentanoate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;(4S)-4-amino-5-hydroxy-5-oxopentanoate;hydrate?
The IUPAC name of potassium;(4S)-4-amino-5-hydroxy-5-oxopentanoate;hydrate (CID 23695977) is potassium;(4S)-4-amino-5-hydroxy-5-oxopentanoate;hydrate.
What is the SMILES notation for potassium;(4S)-4-amino-5-hydroxy-5-oxopentanoate;hydrate?
The canonical SMILES for potassium;(4S)-4-amino-5-hydroxy-5-oxopentanoate;hydrate is N[C@@H](CCC(=O)[O-])C(=O)O.O.[K+].
What is the InChIKey of potassium;(4S)-4-amino-5-hydroxy-5-oxopentanoate;hydrate?
The InChIKey is XIBUKSQTWSKJMQ-QTNFYWBSSA-M. The full InChI is InChI=1S/C5H9NO4.K.H2O/c6-3(5(9)10)1-2-4(7)8;;/h3H,1-2,6H2,(H,7,8)(H,9,10);;1H2/q;+1;/p-1/t3-;;/m0../s1.
What are the key properties of potassium;(4S)-4-amino-5-hydroxy-5-oxopentanoate;hydrate?
potassium;(4S)-4-amino-5-hydroxy-5-oxopentanoate;hydrate has a molecular weight of 203.23 g/mol, XLogP of -5.89, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;(4S)-4-amino-5-hydroxy-5-oxopentanoate;hydrate is sourced from PubChem (CID 23695977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).