About sodium;1,1-dioxo-1,2-benzothiazol-3-olate;hydrate
sodium;1,1-dioxo-1,2-benzothiazol-3-olate;hydrate (PubChem CID 23696271) has the molecular formula C7H6NNaO4S
and a molecular weight of 223.19 g/mol. Its IUPAC name is sodium;1,1-dioxo-1,2-benzothiazol-3-olate;hydrate.
Molecular Properties
| Compound Name | sodium;1,1-dioxo-1,2-benzothiazol-3-olate;hydrate |
| PubChem CID | 23696271 |
| Molecular Formula | C7H6NNaO4S |
| Molecular Weight | 223.19 g/mol |
| Exact Mass | 222.99 |
| IUPAC Name | sodium;1,1-dioxo-1,2-benzothiazol-3-olate;hydrate |
| SMILES | O.O=S1(=O)N=C([O-])c2ccccc21.[Na+] |
| InChI | InChI=1S/C7H5NO3S.Na.H2O/c9-7-5-3-1-2-4-6(5)12(10,11)8-7;;/h1-4H,(H,8,9);;1H2/q;+1;/p-1 |
| InChIKey | ILJOYZVVZZFIKA-UHFFFAOYSA-M |
| XLogP | -4.32 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.19 |
| LogP ≤ 5 | -4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium;1,1-dioxo-1,2-benzothiazol-3-olate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;1,1-dioxo-1,2-benzothiazol-3-olate;hydrate?
The IUPAC name of sodium;1,1-dioxo-1,2-benzothiazol-3-olate;hydrate (CID 23696271) is sodium;1,1-dioxo-1,2-benzothiazol-3-olate;hydrate.
What is the SMILES notation for sodium;1,1-dioxo-1,2-benzothiazol-3-olate;hydrate?
The canonical SMILES for sodium;1,1-dioxo-1,2-benzothiazol-3-olate;hydrate is O.O=S1(=O)N=C([O-])c2ccccc21.[Na+].
What is the InChIKey of sodium;1,1-dioxo-1,2-benzothiazol-3-olate;hydrate?
The InChIKey is ILJOYZVVZZFIKA-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H5NO3S.Na.H2O/c9-7-5-3-1-2-4-6(5)12(10,11)8-7;;/h1-4H,(H,8,9);;1H2/q;+1;/p-1.
What are the key properties of sodium;1,1-dioxo-1,2-benzothiazol-3-olate;hydrate?
sodium;1,1-dioxo-1,2-benzothiazol-3-olate;hydrate has a molecular weight of 223.19 g/mol, XLogP of -4.32, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;1,1-dioxo-1,2-benzothiazol-3-olate;hydrate is sourced from PubChem (CID 23696271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).