About sodium;carbonic acid;8-hydroxy-7-iodoquinoline-5-sulfonate
sodium;carbonic acid;8-hydroxy-7-iodoquinoline-5-sulfonate (PubChem CID 23696930) has the molecular formula C10H7INNaO7S
and a molecular weight of 435.13 g/mol. Its IUPAC name is sodium;carbonic acid;8-hydroxy-7-iodoquinoline-5-sulfonate.
Molecular Properties
| Compound Name | sodium;carbonic acid;8-hydroxy-7-iodoquinoline-5-sulfonate |
| PubChem CID | 23696930 |
| Molecular Formula | C10H7INNaO7S |
| Molecular Weight | 435.13 g/mol |
| Exact Mass | 434.89 |
| IUPAC Name | sodium;carbonic acid;8-hydroxy-7-iodoquinoline-5-sulfonate |
| SMILES | O=C(O)O.O=S(=O)([O-])c1cc(I)c(O)c2ncccc12.[Na+] |
| InChI | InChI=1S/C9H6INO4S.CH2O3.Na/c10-6-4-7(16(13,14)15)5-2-1-3-11-8(5)9(6)12;2-1(3)4;/h1-4,12H,(H,13,14,15);(H2,2,3,4);/q;;+1/p-1 |
| InChIKey | FNXKBSAUKFCXIK-UHFFFAOYSA-M |
| XLogP | -1.32 |
| TPSA | 147.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.13 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;carbonic acid;8-hydroxy-7-iodoquinoline-5-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;carbonic acid;8-hydroxy-7-iodoquinoline-5-sulfonate?
The IUPAC name of sodium;carbonic acid;8-hydroxy-7-iodoquinoline-5-sulfonate (CID 23696930) is sodium;carbonic acid;8-hydroxy-7-iodoquinoline-5-sulfonate.
What is the SMILES notation for sodium;carbonic acid;8-hydroxy-7-iodoquinoline-5-sulfonate?
The canonical SMILES for sodium;carbonic acid;8-hydroxy-7-iodoquinoline-5-sulfonate is O=C(O)O.O=S(=O)([O-])c1cc(I)c(O)c2ncccc12.[Na+].
What is the InChIKey of sodium;carbonic acid;8-hydroxy-7-iodoquinoline-5-sulfonate?
The InChIKey is FNXKBSAUKFCXIK-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H6INO4S.CH2O3.Na/c10-6-4-7(16(13,14)15)5-2-1-3-11-8(5)9(6)12;2-1(3)4;/h1-4,12H,(H,13,14,15);(H2,2,3,4);/q;;+1/p-1.
What are the key properties of sodium;carbonic acid;8-hydroxy-7-iodoquinoline-5-sulfonate?
sodium;carbonic acid;8-hydroxy-7-iodoquinoline-5-sulfonate has a molecular weight of 435.13 g/mol, XLogP of -1.32, 1 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;carbonic acid;8-hydroxy-7-iodoquinoline-5-sulfonate is sourced from PubChem (CID 23696930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).