About sodium;hexane-1-sulfonate;hydrate
sodium;hexane-1-sulfonate;hydrate (PubChem CID 23696962) has the molecular formula C6H15NaO4S
and a molecular weight of 206.24 g/mol. Its IUPAC name is sodium;hexane-1-sulfonate;hydrate.
Molecular Properties
| Compound Name | sodium;hexane-1-sulfonate;hydrate |
| PubChem CID | 23696962 |
| Molecular Formula | C6H15NaO4S |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | sodium;hexane-1-sulfonate;hydrate |
| SMILES | CCCCCCS(=O)(=O)[O-].O.[Na+] |
| InChI | InChI=1S/C6H14O3S.Na.H2O/c1-2-3-4-5-6-10(7,8)9;;/h2-6H2,1H3,(H,7,8,9);;1H2/q;+1;/p-1 |
| InChIKey | CLCGFJYKZGFGSQ-UHFFFAOYSA-M |
| XLogP | -2.71 |
| TPSA | 88.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;hexane-1-sulfonate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hexane-1-sulfonate;hydrate?
The IUPAC name of sodium;hexane-1-sulfonate;hydrate (CID 23696962) is sodium;hexane-1-sulfonate;hydrate.
What is the SMILES notation for sodium;hexane-1-sulfonate;hydrate?
The canonical SMILES for sodium;hexane-1-sulfonate;hydrate is CCCCCCS(=O)(=O)[O-].O.[Na+].
What is the InChIKey of sodium;hexane-1-sulfonate;hydrate?
The InChIKey is CLCGFJYKZGFGSQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H14O3S.Na.H2O/c1-2-3-4-5-6-10(7,8)9;;/h2-6H2,1H3,(H,7,8,9);;1H2/q;+1;/p-1.
What are the key properties of sodium;hexane-1-sulfonate;hydrate?
sodium;hexane-1-sulfonate;hydrate has a molecular weight of 206.24 g/mol, XLogP of -2.71, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hexane-1-sulfonate;hydrate is sourced from PubChem (CID 23696962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).