About sodium (E)-4,4-dimethyl-3-oxopent-1-en-1-olate
sodium (E)-4,4-dimethyl-3-oxopent-1-en-1-olate (PubChem CID 23697484) has the molecular formula C7H11NaO2
and a molecular weight of 150.15 g/mol. Its IUPAC name is sodium (E)-4,4-dimethyl-3-oxopent-1-en-1-olate.
Molecular Properties
| Compound Name | sodium (E)-4,4-dimethyl-3-oxopent-1-en-1-olate |
| PubChem CID | 23697484 |
| Molecular Formula | C7H11NaO2 |
| Molecular Weight | 150.15 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | sodium (E)-4,4-dimethyl-3-oxopent-1-en-1-olate |
| SMILES | CC(C)(C)C(=O)/C=C/[O-].[Na+] |
| InChI | InChI=1S/C7H12O2.Na/c1-7(2,3)6(9)4-5-8;/h4-5,8H,1-3H3;/q;+1/p-1/b5-4+; |
| InChIKey | HXNQWBQXFPNHSH-FXRZFVDSSA-M |
| XLogP | -2.52 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.15 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze sodium (E)-4,4-dimethyl-3-oxopent-1-en-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium (E)-4,4-dimethyl-3-oxopent-1-en-1-olate?
The IUPAC name of sodium (E)-4,4-dimethyl-3-oxopent-1-en-1-olate (CID 23697484) is sodium (E)-4,4-dimethyl-3-oxopent-1-en-1-olate.
What is the SMILES notation for sodium (E)-4,4-dimethyl-3-oxopent-1-en-1-olate?
The canonical SMILES for sodium (E)-4,4-dimethyl-3-oxopent-1-en-1-olate is CC(C)(C)C(=O)/C=C/[O-].[Na+].
What is the InChIKey of sodium (E)-4,4-dimethyl-3-oxopent-1-en-1-olate?
The InChIKey is HXNQWBQXFPNHSH-FXRZFVDSSA-M. The full InChI is InChI=1S/C7H12O2.Na/c1-7(2,3)6(9)4-5-8;/h4-5,8H,1-3H3;/q;+1/p-1/b5-4+;.
What are the key properties of sodium (E)-4,4-dimethyl-3-oxopent-1-en-1-olate?
sodium (E)-4,4-dimethyl-3-oxopent-1-en-1-olate has a molecular weight of 150.15 g/mol, XLogP of -2.52, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium (E)-4,4-dimethyl-3-oxopent-1-en-1-olate is sourced from PubChem (CID 23697484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).