About sodium 4-benzyl-5-(4-chlorophenyl)-1,2,4-triazole-3-thiolate
sodium 4-benzyl-5-(4-chlorophenyl)-1,2,4-triazole-3-thiolate (PubChem CID 23697615) has the molecular formula C15H11ClN3NaS
and a molecular weight of 323.78 g/mol. Its IUPAC name is sodium 4-benzyl-5-(4-chlorophenyl)-1,2,4-triazole-3-thiolate.
Molecular Properties
| Compound Name | sodium 4-benzyl-5-(4-chlorophenyl)-1,2,4-triazole-3-thiolate |
| PubChem CID | 23697615 |
| Molecular Formula | C15H11ClN3NaS |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | sodium 4-benzyl-5-(4-chlorophenyl)-1,2,4-triazole-3-thiolate |
| SMILES | [Na+].[S-]c1nnc(-c2ccc(Cl)cc2)n1Cc1ccccc1 |
| InChI | InChI=1S/C15H12ClN3S.Na/c16-13-8-6-12(7-9-13)14-17-18-15(20)19(14)10-11-4-2-1-3-5-11;/h1-9H,10H2,(H,18,20);/q;+1/p-1 |
| InChIKey | FAVURECPANOVMS-UHFFFAOYSA-M |
| XLogP | 0.56 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze sodium 4-benzyl-5-(4-chlorophenyl)-1,2,4-triazole-3-thiolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 4-benzyl-5-(4-chlorophenyl)-1,2,4-triazole-3-thiolate?
The IUPAC name of sodium 4-benzyl-5-(4-chlorophenyl)-1,2,4-triazole-3-thiolate (CID 23697615) is sodium 4-benzyl-5-(4-chlorophenyl)-1,2,4-triazole-3-thiolate.
What is the SMILES notation for sodium 4-benzyl-5-(4-chlorophenyl)-1,2,4-triazole-3-thiolate?
The canonical SMILES for sodium 4-benzyl-5-(4-chlorophenyl)-1,2,4-triazole-3-thiolate is [Na+].[S-]c1nnc(-c2ccc(Cl)cc2)n1Cc1ccccc1.
What is the InChIKey of sodium 4-benzyl-5-(4-chlorophenyl)-1,2,4-triazole-3-thiolate?
The InChIKey is FAVURECPANOVMS-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H12ClN3S.Na/c16-13-8-6-12(7-9-13)14-17-18-15(20)19(14)10-11-4-2-1-3-5-11;/h1-9H,10H2,(H,18,20);/q;+1/p-1.
What are the key properties of sodium 4-benzyl-5-(4-chlorophenyl)-1,2,4-triazole-3-thiolate?
sodium 4-benzyl-5-(4-chlorophenyl)-1,2,4-triazole-3-thiolate has a molecular weight of 323.78 g/mol, XLogP of 0.56, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 4-benzyl-5-(4-chlorophenyl)-1,2,4-triazole-3-thiolate is sourced from PubChem (CID 23697615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).