C14H13N2NaO5S — CID 23697718
sodium (2S,5R,6E)-3,3-dimethyl-4,4,7-trioxo-6-(pyridin-2-ylmethylidene)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 23697718) has the molecular formula C14H13N2NaO5S and a molecular weight of 344.32 g/mol. Its IUPAC name is sodium (2S,5R,6E)-3,3-dimethyl-4,4,7-trioxo-6-(pyridin-2-ylmethylidene)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | sodium (2S,5R,6E)-3,3-dimethyl-4,4,7-trioxo-6-(pyridin-2-ylmethylidene)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 23697718 |
| Molecular Formula | C14H13N2NaO5S |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | sodium (2S,5R,6E)-3,3-dimethyl-4,4,7-trioxo-6-(pyridin-2-ylmethylidene)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C)[C@H](C(=O)[O-])N2C(=O)/C(=C\c3ccccn3)[C@H]2S1(=O)=O.[Na+] |
| InChI | InChI=1S/C14H14N2O5S.Na/c1-14(2)10(13(18)19)16-11(17)9(12(16)22(14,20)21)7-8-5-3-4-6-15-8;/h3-7,10,12H,1-2H3,(H,18,19);/q;+1/p-1/b9-7+;/t10-,12+;/m0./s1 |
| InChIKey | NTZWNNUVTRFLDD-LQUPPVIRSA-M |
| XLogP | -4.04 |
| TPSA | 107.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | -4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|