C6H7N4NaO5 — CID 23698249
sodium (5R,6R,7S,8S)-6,7,8-trihydroxy-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine-5-carboxylate (PubChem CID 23698249) has the molecular formula C6H7N4NaO5 and a molecular weight of 238.14 g/mol. Its IUPAC name is sodium (5R,6R,7S,8S)-6,7,8-trihydroxy-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine-5-carboxylate.
| Compound Name | sodium (5R,6R,7S,8S)-6,7,8-trihydroxy-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 23698249 |
| Molecular Formula | C6H7N4NaO5 |
| Molecular Weight | 238.14 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | sodium (5R,6R,7S,8S)-6,7,8-trihydroxy-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine-5-carboxylate |
| SMILES | O=C([O-])[C@H]1[C@@H](O)[C@H](O)[C@@H](O)c2nnnn21.[Na+] |
| InChI | InChI=1S/C6H8N4O5.Na/c11-2-1(6(14)15)10-5(7-8-9-10)4(13)3(2)12;/h1-4,11-13H,(H,14,15);/q;+1/p-1/t1-,2-,3+,4-;/m1./s1 |
| InChIKey | YRDBQCJDTQMQAV-GMTPAUIDSA-M |
| XLogP | -7.26 |
| TPSA | 144.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.14 |
| LogP ≤ 5 | -7.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |