C13H9F17NaO5P — CID 23698433
sodium 1,2,2,3,3,4,4,5,5,6,6,7,7,8,9,10,10-heptadecafluorodecyl oxiran-2-ylmethyl phosphate (PubChem CID 23698433) has the molecular formula C13H9F17NaO5P and a molecular weight of 622.14 g/mol. Its IUPAC name is sodium 1,2,2,3,3,4,4,5,5,6,6,7,7,8,9,10,10-heptadecafluorodecyl oxiran-2-ylmethyl phosphate.
| Compound Name | sodium 1,2,2,3,3,4,4,5,5,6,6,7,7,8,9,10,10-heptadecafluorodecyl oxiran-2-ylmethyl phosphate |
|---|---|
| PubChem CID | 23698433 |
| Molecular Formula | C13H9F17NaO5P |
| Molecular Weight | 622.14 g/mol |
| Exact Mass | 621.98 |
| IUPAC Name | sodium 1,2,2,3,3,4,4,5,5,6,6,7,7,8,9,10,10-heptadecafluorodecyl oxiran-2-ylmethyl phosphate |
| SMILES | O=P([O-])(OCC1CO1)OC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)C(F)C(F)F.[Na+] |
| InChI | InChI=1S/C13H10F17O5P.Na/c14-4(6(16)17)5(15)8(19,20)10(23,24)12(27,28)13(29,30)11(25,26)9(21,22)7(18)35-36(31,32)34-2-3-1-33-3;/h3-7H,1-2H2,(H,31,32);/q;+1/p-1 |
| InChIKey | OEBOQXXBURQWKQ-UHFFFAOYSA-M |
| XLogP | 1.94 |
| TPSA | 71.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.14 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|