C17H13F3N3NaO5S — CID 23698551
sodium (4S,5R,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-3-[7-(2,2,2-trifluoroacetyl)imidazo[5,1-b][1,3]thiazol-2-yl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 23698551) has the molecular formula C17H13F3N3NaO5S and a molecular weight of 451.36 g/mol. Its IUPAC name is sodium (4S,5R,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-3-[7-(2,2,2-trifluoroacetyl)imidazo[5,1-b][1,3]thiazol-2-yl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | sodium (4S,5R,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-3-[7-(2,2,2-trifluoroacetyl)imidazo[5,1-b][1,3]thiazol-2-yl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 23698551 |
| Molecular Formula | C17H13F3N3NaO5S |
| Molecular Weight | 451.36 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | sodium (4S,5R,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-3-[7-(2,2,2-trifluoroacetyl)imidazo[5,1-b][1,3]thiazol-2-yl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | C[C@@H](O)[C@H]1C(=O)N2C(C(=O)[O-])=C(c3cn4cnc(C(=O)C(F)(F)F)c4s3)[C@H](C)[C@H]12.[Na+] |
| InChI | InChI=1S/C17H14F3N3O5S.Na/c1-5-8(12(16(27)28)23-11(5)9(6(2)24)14(23)26)7-3-22-4-21-10(15(22)29-7)13(25)17(18,19)20;/h3-6,9,11,24H,1-2H3,(H,27,28);/q;+1/p-1/t5-,6+,9+,11+;/m0./s1 |
| InChIKey | LHJRAULCCBTQIU-VFJPYQFPSA-M |
| XLogP | -2.54 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.36 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |