C16H16N4OS — CID 2369866
1-(3,4-dimethylphenyl)-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)thiourea (PubChem CID 2369866) has the molecular formula C16H16N4OS and a molecular weight of 312.40 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)thiourea.
| Compound Name | 1-(3,4-dimethylphenyl)-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)thiourea |
|---|---|
| PubChem CID | 2369866 |
| Molecular Formula | C16H16N4OS |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)thiourea |
| SMILES | Cc1ccc(NC(=S)Nc2ccc3[nH]c(=O)[nH]c3c2)cc1C |
| InChI | InChI=1S/C16H16N4OS/c1-9-3-4-11(7-10(9)2)17-16(22)18-12-5-6-13-14(8-12)20-15(21)19-13/h3-8H,1-2H3,(H2,17,18,22)(H2,19,20,21) |
| InChIKey | WUCZPGWFIZXWHC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 72.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|