C25H17FNNaO3 — CID 23699195
sodium 9-fluoro-3-(3-methoxyphenyl)-5,6-dihydrobenzo[c]acridine-7-carboxylate (PubChem CID 23699195) has the molecular formula C25H17FNNaO3 and a molecular weight of 421.40 g/mol. Its IUPAC name is sodium 9-fluoro-3-(3-methoxyphenyl)-5,6-dihydrobenzo[c]acridine-7-carboxylate.
| Compound Name | sodium 9-fluoro-3-(3-methoxyphenyl)-5,6-dihydrobenzo[c]acridine-7-carboxylate |
|---|---|
| PubChem CID | 23699195 |
| Molecular Formula | C25H17FNNaO3 |
| Molecular Weight | 421.40 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | sodium 9-fluoro-3-(3-methoxyphenyl)-5,6-dihydrobenzo[c]acridine-7-carboxylate |
| SMILES | COc1cccc(-c2ccc3c(c2)CCc2c-3nc3ccc(F)cc3c2C(=O)[O-])c1.[Na+] |
| InChI | InChI=1S/C25H18FNO3.Na/c1-30-18-4-2-3-14(12-18)15-5-8-19-16(11-15)6-9-20-23(25(28)29)21-13-17(26)7-10-22(21)27-24(19)20;/h2-5,7-8,10-13H,6,9H2,1H3,(H,28,29);/q;+1/p-1 |
| InChIKey | CDLUDSPDBHHBGT-UHFFFAOYSA-M |
| XLogP | 1.18 |
| TPSA | 62.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.40 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |