C27H17ClNNaO8 — CID 23699543
sodium (3'S,4'R,5'S)-4'-(1,3-benzodioxol-5-ylcarbamoyl)-5'-(4-chlorophenyl)-1,3-dioxospiro[indene-2,2'-oxolane]-3'-carboxylate (PubChem CID 23699543) has the molecular formula C27H17ClNNaO8 and a molecular weight of 541.88 g/mol. Its IUPAC name is sodium (3'S,4'R,5'S)-4'-(1,3-benzodioxol-5-ylcarbamoyl)-5'-(4-chlorophenyl)-1,3-dioxospiro[indene-2,2'-oxolane]-3'-carboxylate.
| Compound Name | sodium (3'S,4'R,5'S)-4'-(1,3-benzodioxol-5-ylcarbamoyl)-5'-(4-chlorophenyl)-1,3-dioxospiro[indene-2,2'-oxolane]-3'-carboxylate |
|---|---|
| PubChem CID | 23699543 |
| Molecular Formula | C27H17ClNNaO8 |
| Molecular Weight | 541.88 g/mol |
| Exact Mass | 541.05 |
| IUPAC Name | sodium (3'S,4'R,5'S)-4'-(1,3-benzodioxol-5-ylcarbamoyl)-5'-(4-chlorophenyl)-1,3-dioxospiro[indene-2,2'-oxolane]-3'-carboxylate |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)[C@H]1[C@@H](c2ccc(Cl)cc2)OC2(C(=O)c3ccccc3C2=O)[C@H]1C(=O)[O-].[Na+] |
| InChI | InChI=1S/C27H18ClNO8.Na/c28-14-7-5-13(6-8-14)22-20(25(32)29-15-9-10-18-19(11-15)36-12-35-18)21(26(33)34)27(37-22)23(30)16-3-1-2-4-17(16)24(27)31;/h1-11,20-22H,12H2,(H,29,32)(H,33,34);/q;+1/p-1/t20-,21-,22-;/m1./s1 |
| InChIKey | NPNOVRSALVXMAT-AFYLVLOISA-M |
| XLogP | -0.42 |
| TPSA | 131.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.88 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|