C13H16KNO7 — CID 23699966
potassium 4-[[(3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyamino]benzoate (PubChem CID 23699966) has the molecular formula C13H16KNO7 and a molecular weight of 337.37 g/mol. Its IUPAC name is potassium 4-[[(3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyamino]benzoate.
| Compound Name | potassium 4-[[(3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyamino]benzoate |
|---|---|
| PubChem CID | 23699966 |
| Molecular Formula | C13H16KNO7 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | potassium 4-[[(3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyamino]benzoate |
| SMILES | C[C@@H]1OC(ONc2ccc(C(=O)[O-])cc2)[C@H](O)[C@H](O)[C@H]1O.[K+] |
| InChI | InChI=1S/C13H17NO7.K/c1-6-9(15)10(16)11(17)13(20-6)21-14-8-4-2-7(3-5-8)12(18)19;/h2-6,9-11,13-17H,1H3,(H,18,19);/q;+1/p-1/t6-,9-,10+,11+,13?;/m0./s1 |
| InChIKey | XXTDTKXTNIZRLY-JBXIGMEISA-M |
| XLogP | -4.77 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | -4.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|