C11H13N4NaO6S — CID 23700151
sodium (2S,3S,5R,6R)-6-(hydroxymethyl)-3-methyl-4,4,7-trioxo-3-(triazol-1-ylmethyl)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 23700151) has the molecular formula C11H13N4NaO6S and a molecular weight of 352.30 g/mol. Its IUPAC name is sodium (2S,3S,5R,6R)-6-(hydroxymethyl)-3-methyl-4,4,7-trioxo-3-(triazol-1-ylmethyl)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | sodium (2S,3S,5R,6R)-6-(hydroxymethyl)-3-methyl-4,4,7-trioxo-3-(triazol-1-ylmethyl)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 23700151 |
| Molecular Formula | C11H13N4NaO6S |
| Molecular Weight | 352.30 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | sodium (2S,3S,5R,6R)-6-(hydroxymethyl)-3-methyl-4,4,7-trioxo-3-(triazol-1-ylmethyl)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | C[C@]1(Cn2ccnn2)[C@H](C(=O)[O-])N2C(=O)[C@@H](CO)[C@H]2S1(=O)=O.[Na+] |
| InChI | InChI=1S/C11H14N4O6S.Na/c1-11(5-14-3-2-12-13-14)7(10(18)19)15-8(17)6(4-16)9(15)22(11,20)21;/h2-3,6-7,9,16H,4-5H2,1H3,(H,18,19);/q;+1/p-1/t6-,7+,9-,11+;/m1./s1 |
| InChIKey | QBBWHSLAOSOQME-ZYEZBUCFSA-M |
| XLogP | -6.64 |
| TPSA | 145.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.30 |
| LogP ≤ 5 | -6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |