C9H11KN2OS — CID 23701452
potassium 3-methyl-4-oxo-5,6,7,8-tetrahydroquinazoline-2-thiolate (PubChem CID 23701452) has the molecular formula C9H11KN2OS and a molecular weight of 234.36 g/mol. Its IUPAC name is potassium 3-methyl-4-oxo-5,6,7,8-tetrahydroquinazoline-2-thiolate.
| Compound Name | potassium 3-methyl-4-oxo-5,6,7,8-tetrahydroquinazoline-2-thiolate |
|---|---|
| PubChem CID | 23701452 |
| Molecular Formula | C9H11KN2OS |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | potassium 3-methyl-4-oxo-5,6,7,8-tetrahydroquinazoline-2-thiolate |
| SMILES | Cn1c([S-])nc2c(c1=O)CCCC2.[K+] |
| InChI | InChI=1S/C9H12N2OS.K/c1-11-8(12)6-4-2-3-5-7(6)10-9(11)13;/h2-5H2,1H3,(H,10,13);/q;+1/p-1 |
| InChIKey | WWJWGOUZFAWGAK-UHFFFAOYSA-M |
| XLogP | -2.43 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|