About sodium;naphthalene;oxomethanesulfonate
sodium;naphthalene;oxomethanesulfonate (PubChem CID 23701476) has the molecular formula C11H9NaO4S
and a molecular weight of 260.25 g/mol. Its IUPAC name is sodium;naphthalene;oxomethanesulfonate.
Molecular Properties
| Compound Name | sodium;naphthalene;oxomethanesulfonate |
| PubChem CID | 23701476 |
| Molecular Formula | C11H9NaO4S |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | sodium;naphthalene;oxomethanesulfonate |
| SMILES | O=CS(=O)(=O)[O-].[Na+].c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.CH2O4S.Na/c1-2-6-10-8-4-3-7-9(10)5-1;2-1-6(3,4)5;/h1-8H;1H,(H,3,4,5);/q;;+1/p-1 |
| InChIKey | GTMVFBCNPIRMML-UHFFFAOYSA-M |
| XLogP | -1.43 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze sodium;naphthalene;oxomethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;naphthalene;oxomethanesulfonate?
The IUPAC name of sodium;naphthalene;oxomethanesulfonate (CID 23701476) is sodium;naphthalene;oxomethanesulfonate.
What is the SMILES notation for sodium;naphthalene;oxomethanesulfonate?
The canonical SMILES for sodium;naphthalene;oxomethanesulfonate is O=CS(=O)(=O)[O-].[Na+].c1ccc2ccccc2c1.
What is the InChIKey of sodium;naphthalene;oxomethanesulfonate?
The InChIKey is GTMVFBCNPIRMML-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H8.CH2O4S.Na/c1-2-6-10-8-4-3-7-9(10)5-1;2-1-6(3,4)5;/h1-8H;1H,(H,3,4,5);/q;;+1/p-1.
What are the key properties of sodium;naphthalene;oxomethanesulfonate?
sodium;naphthalene;oxomethanesulfonate has a molecular weight of 260.25 g/mol, XLogP of -1.43, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;naphthalene;oxomethanesulfonate is sourced from PubChem (CID 23701476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).