C10H14NNaO6S — CID 23701546
sodium (2S,5R,6S)-6-[(1S)-1-hydroxyethyl]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 23701546) has the molecular formula C10H14NNaO6S and a molecular weight of 299.28 g/mol. Its IUPAC name is sodium (2S,5R,6S)-6-[(1S)-1-hydroxyethyl]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | sodium (2S,5R,6S)-6-[(1S)-1-hydroxyethyl]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 23701546 |
| Molecular Formula | C10H14NNaO6S |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | sodium (2S,5R,6S)-6-[(1S)-1-hydroxyethyl]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | C[C@H](O)[C@H]1C(=O)N2[C@@H](C(=O)[O-])C(C)(C)S(=O)(=O)[C@H]12.[Na+] |
| InChI | InChI=1S/C10H15NO6S.Na/c1-4(12)5-7(13)11-6(9(14)15)10(2,3)18(16,17)8(5)11;/h4-6,8,12H,1-3H3,(H,14,15);/q;+1/p-1/t4-,5-,6-,8+;/m0./s1 |
| InChIKey | KDVHTJCEYBGKFO-JJZRXBDJSA-M |
| XLogP | -5.52 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | -5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |