About sodium methyl-(2-methyl-1,3-thiazinan-2-yl)phosphinate
sodium methyl-(2-methyl-1,3-thiazinan-2-yl)phosphinate (PubChem CID 23701870) has the molecular formula C6H13NNaO2PS
and a molecular weight of 217.21 g/mol. Its IUPAC name is sodium methyl-(2-methyl-1,3-thiazinan-2-yl)phosphinate.
Molecular Properties
| Compound Name | sodium methyl-(2-methyl-1,3-thiazinan-2-yl)phosphinate |
| PubChem CID | 23701870 |
| Molecular Formula | C6H13NNaO2PS |
| Molecular Weight | 217.21 g/mol |
| Exact Mass | 217.03 |
| IUPAC Name | sodium methyl-(2-methyl-1,3-thiazinan-2-yl)phosphinate |
| SMILES | CC1(P(C)(=O)[O-])NCCCS1.[Na+] |
| InChI | InChI=1S/C6H14NO2PS.Na/c1-6(10(2,8)9)7-4-3-5-11-6;/h7H,3-5H2,1-2H3,(H,8,9);/q;+1/p-1 |
| InChIKey | OBNMKOJIPLFJCG-UHFFFAOYSA-M |
| XLogP | -2.34 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.21 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium methyl-(2-methyl-1,3-thiazinan-2-yl)phosphinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium methyl-(2-methyl-1,3-thiazinan-2-yl)phosphinate?
The IUPAC name of sodium methyl-(2-methyl-1,3-thiazinan-2-yl)phosphinate (CID 23701870) is sodium methyl-(2-methyl-1,3-thiazinan-2-yl)phosphinate.
What is the SMILES notation for sodium methyl-(2-methyl-1,3-thiazinan-2-yl)phosphinate?
The canonical SMILES for sodium methyl-(2-methyl-1,3-thiazinan-2-yl)phosphinate is CC1(P(C)(=O)[O-])NCCCS1.[Na+].
What is the InChIKey of sodium methyl-(2-methyl-1,3-thiazinan-2-yl)phosphinate?
The InChIKey is OBNMKOJIPLFJCG-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H14NO2PS.Na/c1-6(10(2,8)9)7-4-3-5-11-6;/h7H,3-5H2,1-2H3,(H,8,9);/q;+1/p-1.
What are the key properties of sodium methyl-(2-methyl-1,3-thiazinan-2-yl)phosphinate?
sodium methyl-(2-methyl-1,3-thiazinan-2-yl)phosphinate has a molecular weight of 217.21 g/mol, XLogP of -2.34, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium methyl-(2-methyl-1,3-thiazinan-2-yl)phosphinate is sourced from PubChem (CID 23701870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).