C19H23N2NaO7S3 — CID 23701901
sodium 2-(benzylamino)-4-cyclohexylsulfonyl-5-sulfamoylbenzenesulfonate (PubChem CID 23701901) has the molecular formula C19H23N2NaO7S3 and a molecular weight of 510.59 g/mol. Its IUPAC name is sodium 2-(benzylamino)-4-cyclohexylsulfonyl-5-sulfamoylbenzenesulfonate.
| Compound Name | sodium 2-(benzylamino)-4-cyclohexylsulfonyl-5-sulfamoylbenzenesulfonate |
|---|---|
| PubChem CID | 23701901 |
| Molecular Formula | C19H23N2NaO7S3 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.06 |
| IUPAC Name | sodium 2-(benzylamino)-4-cyclohexylsulfonyl-5-sulfamoylbenzenesulfonate |
| SMILES | NS(=O)(=O)c1cc(S(=O)(=O)[O-])c(NCc2ccccc2)cc1S(=O)(=O)C1CCCCC1.[Na+] |
| InChI | InChI=1S/C19H24N2O7S3.Na/c20-30(24,25)19-12-17(31(26,27)28)16(21-13-14-7-3-1-4-8-14)11-18(19)29(22,23)15-9-5-2-6-10-15;/h1,3-4,7-8,11-12,15,21H,2,5-6,9-10,13H2,(H2,20,24,25)(H,26,27,28);/q;+1/p-1 |
| InChIKey | SXQPAAVXJQADHV-UHFFFAOYSA-M |
| XLogP | -1.04 |
| TPSA | 163.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|