About sodium;piperidine;sulfanylmethanethioate
sodium;piperidine;sulfanylmethanethioate (PubChem CID 23702068) has the molecular formula C6H12NNaOS2
and a molecular weight of 201.29 g/mol. Its IUPAC name is sodium;piperidine;sulfanylmethanethioate.
Molecular Properties
| Compound Name | sodium;piperidine;sulfanylmethanethioate |
| PubChem CID | 23702068 |
| Molecular Formula | C6H12NNaOS2 |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.03 |
| IUPAC Name | sodium;piperidine;sulfanylmethanethioate |
| SMILES | C1CCNCC1.O=C([S-])S.[Na+] |
| InChI | InChI=1S/C5H11N.CH2OS2.Na/c1-2-4-6-5-3-1;2-1(3)4;/h6H,1-5H2;(H2,2,3,4);/q;;+1/p-1 |
| InChIKey | COPBZUYQRNRVJM-UHFFFAOYSA-M |
| XLogP | -1.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;piperidine;sulfanylmethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;piperidine;sulfanylmethanethioate?
The IUPAC name of sodium;piperidine;sulfanylmethanethioate (CID 23702068) is sodium;piperidine;sulfanylmethanethioate.
What is the SMILES notation for sodium;piperidine;sulfanylmethanethioate?
The canonical SMILES for sodium;piperidine;sulfanylmethanethioate is C1CCNCC1.O=C([S-])S.[Na+].
What is the InChIKey of sodium;piperidine;sulfanylmethanethioate?
The InChIKey is COPBZUYQRNRVJM-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H11N.CH2OS2.Na/c1-2-4-6-5-3-1;2-1(3)4;/h6H,1-5H2;(H2,2,3,4);/q;;+1/p-1.
What are the key properties of sodium;piperidine;sulfanylmethanethioate?
sodium;piperidine;sulfanylmethanethioate has a molecular weight of 201.29 g/mol, XLogP of -1.65, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;piperidine;sulfanylmethanethioate is sourced from PubChem (CID 23702068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).