About sodium;naphthalen-1-yl hydrogen phosphate;hydrate
sodium;naphthalen-1-yl hydrogen phosphate;hydrate (PubChem CID 23702143) has the molecular formula C10H10NaO5P
and a molecular weight of 264.15 g/mol. Its IUPAC name is sodium;naphthalen-1-yl hydrogen phosphate;hydrate.
Molecular Properties
| Compound Name | sodium;naphthalen-1-yl hydrogen phosphate;hydrate |
| PubChem CID | 23702143 |
| Molecular Formula | C10H10NaO5P |
| Molecular Weight | 264.15 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | sodium;naphthalen-1-yl hydrogen phosphate;hydrate |
| SMILES | O.O=P([O-])(O)Oc1cccc2ccccc12.[Na+] |
| InChI | InChI=1S/C10H9O4P.Na.H2O/c11-15(12,13)14-10-7-3-5-8-4-1-2-6-9(8)10;;/h1-7H,(H2,11,12,13);;1H2/q;+1;/p-1 |
| InChIKey | NSWUDGODQXQNON-UHFFFAOYSA-M |
| XLogP | -2.14 |
| TPSA | 101.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.15 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium;naphthalen-1-yl hydrogen phosphate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;naphthalen-1-yl hydrogen phosphate;hydrate?
The IUPAC name of sodium;naphthalen-1-yl hydrogen phosphate;hydrate (CID 23702143) is sodium;naphthalen-1-yl hydrogen phosphate;hydrate.
What is the SMILES notation for sodium;naphthalen-1-yl hydrogen phosphate;hydrate?
The canonical SMILES for sodium;naphthalen-1-yl hydrogen phosphate;hydrate is O.O=P([O-])(O)Oc1cccc2ccccc12.[Na+].
What is the InChIKey of sodium;naphthalen-1-yl hydrogen phosphate;hydrate?
The InChIKey is NSWUDGODQXQNON-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H9O4P.Na.H2O/c11-15(12,13)14-10-7-3-5-8-4-1-2-6-9(8)10;;/h1-7H,(H2,11,12,13);;1H2/q;+1;/p-1.
What are the key properties of sodium;naphthalen-1-yl hydrogen phosphate;hydrate?
sodium;naphthalen-1-yl hydrogen phosphate;hydrate has a molecular weight of 264.15 g/mol, XLogP of -2.14, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;naphthalen-1-yl hydrogen phosphate;hydrate is sourced from PubChem (CID 23702143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).