C21H29NaO4 — CID 23702775
sodium 2-[(1S,3R)-1-hydroxy-3-[(E)-3-hydroxy-7-phenylhept-1-enyl]cyclohexyl]acetate (PubChem CID 23702775) has the molecular formula C21H29NaO4 and a molecular weight of 368.45 g/mol. Its IUPAC name is sodium 2-[(1S,3R)-1-hydroxy-3-[(E)-3-hydroxy-7-phenylhept-1-enyl]cyclohexyl]acetate.
| Compound Name | sodium 2-[(1S,3R)-1-hydroxy-3-[(E)-3-hydroxy-7-phenylhept-1-enyl]cyclohexyl]acetate |
|---|---|
| PubChem CID | 23702775 |
| Molecular Formula | C21H29NaO4 |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | sodium 2-[(1S,3R)-1-hydroxy-3-[(E)-3-hydroxy-7-phenylhept-1-enyl]cyclohexyl]acetate |
| SMILES | O=C([O-])C[C@]1(O)CCC[C@@H](/C=C/C(O)CCCCc2ccccc2)C1.[Na+] |
| InChI | InChI=1S/C21H30O4.Na/c22-19(11-5-4-9-17-7-2-1-3-8-17)13-12-18-10-6-14-21(25,15-18)16-20(23)24;/h1-3,7-8,12-13,18-19,22,25H,4-6,9-11,14-16H2,(H,23,24);/q;+1/p-1/b13-12+;/t18-,19?,21-;/m0./s1 |
| InChIKey | MJGHSHZZATUGPV-ZVYUWOCZSA-M |
| XLogP | -0.62 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|