C27H34NNaO9 — CID 23703105
sodium 4-[(2E,4E)-6-(2-methoxycarbonyl-3,5,9-trimethyl-7-oxo-4,11,12-trioxatricyclo[6.3.1.01,5]dodecan-10-yl)-4-methylhepta-2,4-dienoyl]-1-methyl-5-oxo-2H-pyrrol-3-olate (PubChem CID 23703105) has the molecular formula C27H34NNaO9 and a molecular weight of 539.56 g/mol. Its IUPAC name is sodium 4-[(2E,4E)-6-(2-methoxycarbonyl-3,5,9-trimethyl-7-oxo-4,11,12-trioxatricyclo[6.3.1.01,5]dodecan-10-yl)-4-methylhepta-2,4-dienoyl]-1-methyl-5-oxo-2H-pyrrol-3-olate.
| Compound Name | sodium 4-[(2E,4E)-6-(2-methoxycarbonyl-3,5,9-trimethyl-7-oxo-4,11,12-trioxatricyclo[6.3.1.01,5]dodecan-10-yl)-4-methylhepta-2,4-dienoyl]-1-methyl-5-oxo-2H-pyrrol-3-olate |
|---|---|
| PubChem CID | 23703105 |
| Molecular Formula | C27H34NNaO9 |
| Molecular Weight | 539.56 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | sodium 4-[(2E,4E)-6-(2-methoxycarbonyl-3,5,9-trimethyl-7-oxo-4,11,12-trioxatricyclo[6.3.1.01,5]dodecan-10-yl)-4-methylhepta-2,4-dienoyl]-1-methyl-5-oxo-2H-pyrrol-3-olate |
| SMILES | COC(=O)C1C(C)OC2(C)CC(=O)C3OC12OC(C(C)/C=C(C)/C=C/C(=O)C1=C([O-])CN(C)C1=O)C3C.[Na+] |
| InChI | InChI=1S/C27H35NO9.Na/c1-13(8-9-17(29)20-19(31)12-28(6)24(20)32)10-14(2)22-15(3)23-18(30)11-26(5)27(36-22,37-23)21(16(4)35-26)25(33)34-7;/h8-10,14-16,21-23,31H,11-12H2,1-7H3;/q;+1/p-1/b9-8+,13-10+; |
| InChIKey | HKDXPHZZLFBZGH-VQLSARQJSA-M |
| XLogP | -2.16 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.56 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|