C20H31N2NaO3 — CID 23703884
sodium 5,5-bis(2-cyclohexylethyl)-4,6-dioxo-1H-pyrimidin-2-olate (PubChem CID 23703884) has the molecular formula C20H31N2NaO3 and a molecular weight of 370.47 g/mol. Its IUPAC name is sodium 5,5-bis(2-cyclohexylethyl)-4,6-dioxo-1H-pyrimidin-2-olate.
| Compound Name | sodium 5,5-bis(2-cyclohexylethyl)-4,6-dioxo-1H-pyrimidin-2-olate |
|---|---|
| PubChem CID | 23703884 |
| Molecular Formula | C20H31N2NaO3 |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | sodium 5,5-bis(2-cyclohexylethyl)-4,6-dioxo-1H-pyrimidin-2-olate |
| SMILES | O=C1N=C([O-])NC(=O)C1(CCC1CCCCC1)CCC1CCCCC1.[Na+] |
| InChI | InChI=1S/C20H32N2O3.Na/c23-17-20(18(24)22-19(25)21-17,13-11-15-7-3-1-4-8-15)14-12-16-9-5-2-6-10-16;/h15-16H,1-14H2,(H2,21,22,23,24,25);/q;+1/p-1 |
| InChIKey | OWZSTAYCTRCDHP-UHFFFAOYSA-M |
| XLogP | 0.07 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|