C16H16FN2NaO4 — CID 23703984
sodium 5-ethyl-5-[4-(4-fluorophenyl)-4-oxobutyl]pyrimidin-3-ide-2,4,6-trione (PubChem CID 23703984) has the molecular formula C16H16FN2NaO4 and a molecular weight of 342.30 g/mol. Its IUPAC name is sodium 5-ethyl-5-[4-(4-fluorophenyl)-4-oxobutyl]pyrimidin-3-ide-2,4,6-trione.
| Compound Name | sodium 5-ethyl-5-[4-(4-fluorophenyl)-4-oxobutyl]pyrimidin-3-ide-2,4,6-trione |
|---|---|
| PubChem CID | 23703984 |
| Molecular Formula | C16H16FN2NaO4 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | sodium 5-ethyl-5-[4-(4-fluorophenyl)-4-oxobutyl]pyrimidin-3-ide-2,4,6-trione |
| SMILES | CCC1(CCCC(=O)c2ccc(F)cc2)C(=O)[N-]C(=O)NC1=O.[Na+] |
| InChI | InChI=1S/C16H17FN2O4.Na/c1-2-16(13(21)18-15(23)19-14(16)22)9-3-4-12(20)10-5-7-11(17)8-6-10;/h5-8H,2-4,9H2,1H3,(H2,18,19,21,22,23);/q;+1/p-1 |
| InChIKey | JXPRQOJYOYROLN-UHFFFAOYSA-M |
| XLogP | -0.27 |
| TPSA | 94.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|