About sodium;3-acetyl-6-methylpyran-3-ide-2,4-dione;hydrate
sodium;3-acetyl-6-methylpyran-3-ide-2,4-dione;hydrate (PubChem CID 23703987) has the molecular formula C8H9NaO5
and a molecular weight of 208.14 g/mol. Its IUPAC name is sodium;3-acetyl-6-methylpyran-3-ide-2,4-dione;hydrate.
Molecular Properties
| Compound Name | sodium;3-acetyl-6-methylpyran-3-ide-2,4-dione;hydrate |
| PubChem CID | 23703987 |
| Molecular Formula | C8H9NaO5 |
| Molecular Weight | 208.14 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | sodium;3-acetyl-6-methylpyran-3-ide-2,4-dione;hydrate |
| SMILES | CC(=O)[c-]1c(=O)cc(C)oc1=O.O.[Na+] |
| InChI | InChI=1S/C8H7O4.Na.H2O/c1-4-3-6(10)7(5(2)9)8(11)12-4;;/h3H,1-2H3;;1H2/q-1;+1; |
| InChIKey | AFIQQQWSAQPUQO-UHFFFAOYSA-N |
| XLogP | -3.59 |
| TPSA | 95.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.14 |
| LogP ≤ 5 | -3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze sodium;3-acetyl-6-methylpyran-3-ide-2,4-dione;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;3-acetyl-6-methylpyran-3-ide-2,4-dione;hydrate?
The IUPAC name of sodium;3-acetyl-6-methylpyran-3-ide-2,4-dione;hydrate (CID 23703987) is sodium;3-acetyl-6-methylpyran-3-ide-2,4-dione;hydrate.
What is the SMILES notation for sodium;3-acetyl-6-methylpyran-3-ide-2,4-dione;hydrate?
The canonical SMILES for sodium;3-acetyl-6-methylpyran-3-ide-2,4-dione;hydrate is CC(=O)[c-]1c(=O)cc(C)oc1=O.O.[Na+].
What is the InChIKey of sodium;3-acetyl-6-methylpyran-3-ide-2,4-dione;hydrate?
The InChIKey is AFIQQQWSAQPUQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7O4.Na.H2O/c1-4-3-6(10)7(5(2)9)8(11)12-4;;/h3H,1-2H3;;1H2/q-1;+1;.
What are the key properties of sodium;3-acetyl-6-methylpyran-3-ide-2,4-dione;hydrate?
sodium;3-acetyl-6-methylpyran-3-ide-2,4-dione;hydrate has a molecular weight of 208.14 g/mol, XLogP of -3.59, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;3-acetyl-6-methylpyran-3-ide-2,4-dione;hydrate is sourced from PubChem (CID 23703987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).