C9H8N2OS2 — CID 2370424
3-methyl-N-(1,3-thiazol-2-yl)thiophene-2-carboxamide (PubChem CID 2370424) has the molecular formula C9H8N2OS2 and a molecular weight of 224.31 g/mol. Its IUPAC name is 3-methyl-N-(1,3-thiazol-2-yl)thiophene-2-carboxamide.
| Compound Name | 3-methyl-N-(1,3-thiazol-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 2370424 |
| Molecular Formula | C9H8N2OS2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.01 |
| IUPAC Name | 3-methyl-N-(1,3-thiazol-2-yl)thiophene-2-carboxamide |
| SMILES | Cc1ccsc1C(=O)Nc1nccs1 |
| InChI | InChI=1S/C9H8N2OS2/c1-6-2-4-13-7(6)8(12)11-9-10-3-5-14-9/h2-5H,1H3,(H,10,11,12) |
| InChIKey | HZAGOXGWDWIBJC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |