About pentane-2,4-dione;rubidium(1+)
pentane-2,4-dione;rubidium(1+) (PubChem CID 23704362) has the molecular formula C5H7O2Rb
and a molecular weight of 184.58 g/mol. Its IUPAC name is pentane-2,4-dione;rubidium(1+).
Molecular Properties
| Compound Name | pentane-2,4-dione;rubidium(1+) |
| PubChem CID | 23704362 |
| Molecular Formula | C5H7O2Rb |
| Molecular Weight | 184.58 g/mol |
| Exact Mass | 183.96 |
| IUPAC Name | pentane-2,4-dione;rubidium(1+) |
| SMILES | CC(=O)[CH-]C(C)=O.[Rb+] |
| InChI | InChI=1S/C5H7O2.Rb/c1-4(6)3-5(2)7;/h3H,1-2H3;/q-1;+1 |
| InChIKey | JEUVQIAFCDULSP-UHFFFAOYSA-N |
| XLogP | -2.63 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.58 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze pentane-2,4-dione;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentane-2,4-dione;rubidium(1+)?
The IUPAC name of pentane-2,4-dione;rubidium(1+) (CID 23704362) is pentane-2,4-dione;rubidium(1+).
What is the SMILES notation for pentane-2,4-dione;rubidium(1+)?
The canonical SMILES for pentane-2,4-dione;rubidium(1+) is CC(=O)[CH-]C(C)=O.[Rb+].
What is the InChIKey of pentane-2,4-dione;rubidium(1+)?
The InChIKey is JEUVQIAFCDULSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7O2.Rb/c1-4(6)3-5(2)7;/h3H,1-2H3;/q-1;+1.
What are the key properties of pentane-2,4-dione;rubidium(1+)?
pentane-2,4-dione;rubidium(1+) has a molecular weight of 184.58 g/mol, XLogP of -2.63, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentane-2,4-dione;rubidium(1+) is sourced from PubChem (CID 23704362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).