About potassium (6-benzoylnaphthalen-2-yl) sulfate
potassium (6-benzoylnaphthalen-2-yl) sulfate (PubChem CID 23704364) has the molecular formula C17H11KO5S
and a molecular weight of 366.44 g/mol. Its IUPAC name is potassium (6-benzoylnaphthalen-2-yl) sulfate.
Molecular Properties
| Compound Name | potassium (6-benzoylnaphthalen-2-yl) sulfate |
| PubChem CID | 23704364 |
| Molecular Formula | C17H11KO5S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | potassium (6-benzoylnaphthalen-2-yl) sulfate |
| SMILES | O=C(c1ccccc1)c1ccc2cc(OS(=O)(=O)[O-])ccc2c1.[K+] |
| InChI | InChI=1S/C17H12O5S.K/c18-17(12-4-2-1-3-5-12)15-7-6-14-11-16(22-23(19,20)21)9-8-13(14)10-15;/h1-11H,(H,19,20,21);/q;+1/p-1 |
| InChIKey | QDFLHEXSNOIYQU-UHFFFAOYSA-M |
| XLogP | -0.09 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze potassium (6-benzoylnaphthalen-2-yl) sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium (6-benzoylnaphthalen-2-yl) sulfate?
The IUPAC name of potassium (6-benzoylnaphthalen-2-yl) sulfate (CID 23704364) is potassium (6-benzoylnaphthalen-2-yl) sulfate.
What is the SMILES notation for potassium (6-benzoylnaphthalen-2-yl) sulfate?
The canonical SMILES for potassium (6-benzoylnaphthalen-2-yl) sulfate is O=C(c1ccccc1)c1ccc2cc(OS(=O)(=O)[O-])ccc2c1.[K+].
What is the InChIKey of potassium (6-benzoylnaphthalen-2-yl) sulfate?
The InChIKey is QDFLHEXSNOIYQU-UHFFFAOYSA-M. The full InChI is InChI=1S/C17H12O5S.K/c18-17(12-4-2-1-3-5-12)15-7-6-14-11-16(22-23(19,20)21)9-8-13(14)10-15;/h1-11H,(H,19,20,21);/q;+1/p-1.
What are the key properties of potassium (6-benzoylnaphthalen-2-yl) sulfate?
potassium (6-benzoylnaphthalen-2-yl) sulfate has a molecular weight of 366.44 g/mol, XLogP of -0.09, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for potassium (6-benzoylnaphthalen-2-yl) sulfate is sourced from PubChem (CID 23704364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).