About [2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] cyclopentanecarboxylate
[2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] cyclopentanecarboxylate (PubChem CID 2370579) has the molecular formula C14H19N3O5
and a molecular weight of 309.32 g/mol. Its IUPAC name is [2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] cyclopentanecarboxylate.
Molecular Properties
| Compound Name | [2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] cyclopentanecarboxylate |
| PubChem CID | 2370579 |
| Molecular Formula | C14H19N3O5 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | [2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] cyclopentanecarboxylate |
| SMILES | Cn1c(N)c(C(=O)COC(=O)C2CCCC2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C14H19N3O5/c1-16-11(15)10(12(19)17(2)14(16)21)9(18)7-22-13(20)8-5-3-4-6-8/h8H,3-7,15H2,1-2H3 |
| InChIKey | GTNNWTULKAFJEH-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] cyclopentanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] cyclopentanecarboxylate?
The IUPAC name of [2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] cyclopentanecarboxylate (CID 2370579) is [2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] cyclopentanecarboxylate.
What is the SMILES notation for [2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] cyclopentanecarboxylate?
The canonical SMILES for [2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] cyclopentanecarboxylate is Cn1c(N)c(C(=O)COC(=O)C2CCCC2)c(=O)n(C)c1=O.
What is the InChIKey of [2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] cyclopentanecarboxylate?
The InChIKey is GTNNWTULKAFJEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O5/c1-16-11(15)10(12(19)17(2)14(16)21)9(18)7-22-13(20)8-5-3-4-6-8/h8H,3-7,15H2,1-2H3.
What are the key properties of [2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] cyclopentanecarboxylate?
[2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] cyclopentanecarboxylate has a molecular weight of 309.32 g/mol, XLogP of -0.42, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] cyclopentanecarboxylate is sourced from PubChem (CID 2370579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).