C27H23N2NaO4S — CID 23705831
sodium (E)-2-(2,1,3-benzothiadiazol-5-yl)-3-[(4-methylphenyl)methyl]-4-oxo-4-(4-propan-2-yloxyphenyl)but-2-enoate (PubChem CID 23705831) has the molecular formula C27H23N2NaO4S and a molecular weight of 494.55 g/mol. Its IUPAC name is sodium (E)-2-(2,1,3-benzothiadiazol-5-yl)-3-[(4-methylphenyl)methyl]-4-oxo-4-(4-propan-2-yloxyphenyl)but-2-enoate.
| Compound Name | sodium (E)-2-(2,1,3-benzothiadiazol-5-yl)-3-[(4-methylphenyl)methyl]-4-oxo-4-(4-propan-2-yloxyphenyl)but-2-enoate |
|---|---|
| PubChem CID | 23705831 |
| Molecular Formula | C27H23N2NaO4S |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | sodium (E)-2-(2,1,3-benzothiadiazol-5-yl)-3-[(4-methylphenyl)methyl]-4-oxo-4-(4-propan-2-yloxyphenyl)but-2-enoate |
| SMILES | Cc1ccc(C/C(C(=O)c2ccc(OC(C)C)cc2)=C(\C(=O)[O-])c2ccc3nsnc3c2)cc1.[Na+] |
| InChI | InChI=1S/C27H24N2O4S.Na/c1-16(2)33-21-11-8-19(9-12-21)26(30)22(14-18-6-4-17(3)5-7-18)25(27(31)32)20-10-13-23-24(15-20)29-34-28-23;/h4-13,15-16H,14H2,1-3H3,(H,31,32);/q;+1/p-1/b25-22+; |
| InChIKey | CPRSQIXLGDBCFU-OSMRDGEFSA-M |
| XLogP | 1.42 |
| TPSA | 92.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|