C25H19N2NaO4S2 — CID 23705836
sodium (E)-2-(2,1,3-benzothiadiazol-5-yl)-3-[(2-methoxyphenyl)methyl]-4-(4-methylsulfanylphenyl)-4-oxobut-2-enoate (PubChem CID 23705836) has the molecular formula C25H19N2NaO4S2 and a molecular weight of 498.56 g/mol. Its IUPAC name is sodium (E)-2-(2,1,3-benzothiadiazol-5-yl)-3-[(2-methoxyphenyl)methyl]-4-(4-methylsulfanylphenyl)-4-oxobut-2-enoate.
| Compound Name | sodium (E)-2-(2,1,3-benzothiadiazol-5-yl)-3-[(2-methoxyphenyl)methyl]-4-(4-methylsulfanylphenyl)-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 23705836 |
| Molecular Formula | C25H19N2NaO4S2 |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | sodium (E)-2-(2,1,3-benzothiadiazol-5-yl)-3-[(2-methoxyphenyl)methyl]-4-(4-methylsulfanylphenyl)-4-oxobut-2-enoate |
| SMILES | COc1ccccc1C/C(C(=O)c1ccc(SC)cc1)=C(\C(=O)[O-])c1ccc2nsnc2c1.[Na+] |
| InChI | InChI=1S/C25H20N2O4S2.Na/c1-31-22-6-4-3-5-16(22)13-19(24(28)15-7-10-18(32-2)11-8-15)23(25(29)30)17-9-12-20-21(14-17)27-33-26-20;/h3-12,14H,13H2,1-2H3,(H,29,30);/q;+1/p-1/b23-19+; |
| InChIKey | KRTBTZDTLGMINI-IMPZXOFZSA-M |
| XLogP | 1.05 |
| TPSA | 92.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|