C16H10NNaO4S — CID 23705998
sodium 5-oxo-6,11-dihydroindeno[1,2-c]isoquinoline-9-sulfonate (PubChem CID 23705998) has the molecular formula C16H10NNaO4S and a molecular weight of 335.32 g/mol. Its IUPAC name is sodium 5-oxo-6,11-dihydroindeno[1,2-c]isoquinoline-9-sulfonate.
| Compound Name | sodium 5-oxo-6,11-dihydroindeno[1,2-c]isoquinoline-9-sulfonate |
|---|---|
| PubChem CID | 23705998 |
| Molecular Formula | C16H10NNaO4S |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | sodium 5-oxo-6,11-dihydroindeno[1,2-c]isoquinoline-9-sulfonate |
| SMILES | O=c1[nH]c2c(c3ccccc13)Cc1cc(S(=O)(=O)[O-])ccc1-2.[Na+] |
| InChI | InChI=1S/C16H11NO4S.Na/c18-16-13-4-2-1-3-12(13)14-8-9-7-10(22(19,20)21)5-6-11(9)15(14)17-16;/h1-7H,8H2,(H,17,18)(H,19,20,21);/q;+1/p-1 |
| InChIKey | BJDIKZFNYGQVNH-UHFFFAOYSA-M |
| XLogP | -0.99 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|