C17H12FKN2O2S — CID 23706068
potassium 2-benzylsulfanyl-1-(4-fluorophenyl)-6-oxopyrimidin-4-olate (PubChem CID 23706068) has the molecular formula C17H12FKN2O2S and a molecular weight of 366.46 g/mol. Its IUPAC name is potassium 2-benzylsulfanyl-1-(4-fluorophenyl)-6-oxopyrimidin-4-olate.
| Compound Name | potassium 2-benzylsulfanyl-1-(4-fluorophenyl)-6-oxopyrimidin-4-olate |
|---|---|
| PubChem CID | 23706068 |
| Molecular Formula | C17H12FKN2O2S |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | potassium 2-benzylsulfanyl-1-(4-fluorophenyl)-6-oxopyrimidin-4-olate |
| SMILES | O=c1cc([O-])nc(SCc2ccccc2)n1-c1ccc(F)cc1.[K+] |
| InChI | InChI=1S/C17H13FN2O2S.K/c18-13-6-8-14(9-7-13)20-16(22)10-15(21)19-17(20)23-11-12-4-2-1-3-5-12;/h1-10,21H,11H2;/q;+1/p-1 |
| InChIKey | RYSIYBLRKLWCND-UHFFFAOYSA-M |
| XLogP | -0.26 |
| TPSA | 57.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |