About sodium;2-(3-fluoro-4-phenylphenyl)propanoate;dihydrate
sodium;2-(3-fluoro-4-phenylphenyl)propanoate;dihydrate (PubChem CID 23706216) has the molecular formula C15H16FNaO4
and a molecular weight of 302.28 g/mol. Its IUPAC name is sodium;2-(3-fluoro-4-phenylphenyl)propanoate;dihydrate.
Molecular Properties
| Compound Name | sodium;2-(3-fluoro-4-phenylphenyl)propanoate;dihydrate |
| PubChem CID | 23706216 |
| Molecular Formula | C15H16FNaO4 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | sodium;2-(3-fluoro-4-phenylphenyl)propanoate;dihydrate |
| SMILES | CC(C(=O)[O-])c1ccc(-c2ccccc2)c(F)c1.O.O.[Na+] |
| InChI | InChI=1S/C15H13FO2.Na.2H2O/c1-10(15(17)18)12-7-8-13(14(16)9-12)11-5-3-2-4-6-11;;;/h2-10H,1H3,(H,17,18);;2*1H2/q;+1;;/p-1 |
| InChIKey | GNMBMOULKUXEQF-UHFFFAOYSA-M |
| XLogP | -2.30 |
| TPSA | 103.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium;2-(3-fluoro-4-phenylphenyl)propanoate;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-(3-fluoro-4-phenylphenyl)propanoate;dihydrate?
The IUPAC name of sodium;2-(3-fluoro-4-phenylphenyl)propanoate;dihydrate (CID 23706216) is sodium;2-(3-fluoro-4-phenylphenyl)propanoate;dihydrate.
What is the SMILES notation for sodium;2-(3-fluoro-4-phenylphenyl)propanoate;dihydrate?
The canonical SMILES for sodium;2-(3-fluoro-4-phenylphenyl)propanoate;dihydrate is CC(C(=O)[O-])c1ccc(-c2ccccc2)c(F)c1.O.O.[Na+].
What is the InChIKey of sodium;2-(3-fluoro-4-phenylphenyl)propanoate;dihydrate?
The InChIKey is GNMBMOULKUXEQF-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H13FO2.Na.2H2O/c1-10(15(17)18)12-7-8-13(14(16)9-12)11-5-3-2-4-6-11;;;/h2-10H,1H3,(H,17,18);;2*1H2/q;+1;;/p-1.
What are the key properties of sodium;2-(3-fluoro-4-phenylphenyl)propanoate;dihydrate?
sodium;2-(3-fluoro-4-phenylphenyl)propanoate;dihydrate has a molecular weight of 302.28 g/mol, XLogP of -2.30, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-(3-fluoro-4-phenylphenyl)propanoate;dihydrate is sourced from PubChem (CID 23706216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).