C16H19N2NaO8S — CID 23706504
sodium (2S,3S)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxo-3-(phenylmethoxycarbonylamino)azetidine-1-sulfonate (PubChem CID 23706504) has the molecular formula C16H19N2NaO8S and a molecular weight of 422.39 g/mol. Its IUPAC name is sodium (2S,3S)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxo-3-(phenylmethoxycarbonylamino)azetidine-1-sulfonate.
| Compound Name | sodium (2S,3S)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxo-3-(phenylmethoxycarbonylamino)azetidine-1-sulfonate |
|---|---|
| PubChem CID | 23706504 |
| Molecular Formula | C16H19N2NaO8S |
| Molecular Weight | 422.39 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | sodium (2S,3S)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxo-3-(phenylmethoxycarbonylamino)azetidine-1-sulfonate |
| SMILES | CC1(C)OC[C@@H]([C@@H]2[C@H](NC(=O)OCc3ccccc3)C(=O)N2S(=O)(=O)[O-])O1.[Na+] |
| InChI | InChI=1S/C16H20N2O8S.Na/c1-16(2)25-9-11(26-16)13-12(14(19)18(13)27(21,22)23)17-15(20)24-8-10-6-4-3-5-7-10;/h3-7,11-13H,8-9H2,1-2H3,(H,17,20)(H,21,22,23);/q;+1/p-1/t11-,12-,13+;/m0./s1 |
| InChIKey | IQVFKHWAYUOJGL-GRMSKOJTSA-M |
| XLogP | -2.89 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.39 |
| LogP ≤ 5 | -2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|