C31H27ClFN3O3 — CID 2370727
[6-(4-chlorophenyl)-2-[(2-fluorophenoxy)methyl]-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-trien-5-yl]-(2-ethoxyphenyl)methanone (PubChem CID 2370727) has the molecular formula C31H27ClFN3O3 and a molecular weight of 544.03 g/mol. Its IUPAC name is [6-(4-chlorophenyl)-2-[(2-fluorophenoxy)methyl]-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-trien-5-yl]-(2-ethoxyphenyl)methanone.
| Compound Name | [6-(4-chlorophenyl)-2-[(2-fluorophenoxy)methyl]-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-trien-5-yl]-(2-ethoxyphenyl)methanone |
|---|---|
| PubChem CID | 2370727 |
| Molecular Formula | C31H27ClFN3O3 |
| Molecular Weight | 544.03 g/mol |
| Exact Mass | 543.17 |
| IUPAC Name | [6-(4-chlorophenyl)-2-[(2-fluorophenoxy)methyl]-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-trien-5-yl]-(2-ethoxyphenyl)methanone |
| SMILES | CCOc1ccccc1C(=O)c1c(-c2ccc(Cl)cc2)c2c3n(c(COc4ccccc4F)nn13)CCCC2 |
| InChI | InChI=1S/C31H27ClFN3O3/c1-2-38-25-12-5-3-9-22(25)30(37)29-28(20-14-16-21(32)17-15-20)23-10-7-8-18-35-27(34-36(29)31(23)35)19-39-26-13-6-4-11-24(26)33/h3-6,9,11-17H,2,7-8,10,18-19H2,1H3 |
| InChIKey | QKFJVCJDRRMKNP-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 57.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.03 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |