About potassium 2-nitro-1H-imidazole
potassium 2-nitro-1H-imidazole (PubChem CID 23707816) has the molecular formula C3H3KN3O2+
and a molecular weight of 152.17 g/mol. Its IUPAC name is potassium 2-nitro-1H-imidazole.
Molecular Properties
| Compound Name | potassium 2-nitro-1H-imidazole |
| PubChem CID | 23707816 |
| Molecular Formula | C3H3KN3O2+ |
| Molecular Weight | 152.17 g/mol |
| Exact Mass | 151.99 |
| IUPAC Name | potassium 2-nitro-1H-imidazole |
| SMILES | O=[N+]([O-])c1ncc[nH]1.[K+] |
| InChI | InChI=1S/C3H3N3O2.K/c7-6(8)3-4-1-2-5-3;/h1-2H,(H,4,5);/q;+1 |
| InChIKey | FWZLQUJWLXPURD-UHFFFAOYSA-N |
| XLogP | -2.68 |
| TPSA | 71.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.17 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze potassium 2-nitro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 2-nitro-1H-imidazole?
The IUPAC name of potassium 2-nitro-1H-imidazole (CID 23707816) is potassium 2-nitro-1H-imidazole.
What is the SMILES notation for potassium 2-nitro-1H-imidazole?
The canonical SMILES for potassium 2-nitro-1H-imidazole is O=[N+]([O-])c1ncc[nH]1.[K+].
What is the InChIKey of potassium 2-nitro-1H-imidazole?
The InChIKey is FWZLQUJWLXPURD-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3N3O2.K/c7-6(8)3-4-1-2-5-3;/h1-2H,(H,4,5);/q;+1.
What are the key properties of potassium 2-nitro-1H-imidazole?
potassium 2-nitro-1H-imidazole has a molecular weight of 152.17 g/mol, XLogP of -2.68, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2-nitro-1H-imidazole is sourced from PubChem (CID 23707816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).