sodium 4-undecan-3-ylbenzenesulfonate

C17H27NaO3S — CID 23707964

IUPACsodium 4-undecan-3-ylbenzenesulfonate
SMILESCCCCCCCCC(CC)c1ccc(S(=O)(=O)[O-])cc1.[Na+]
InChIInChI=1S/C17H28O3S.Na/c1-3-5-6-7-8-9-10-15(4-2)16-11-13-17(14-12-16)21(18,19)20;/h11-15H,3-10H2,1-2H3,(H,18,19,20);/q;+1/p-1
InChIKeyHUKUZKXWBQJYTO-UHFFFAOYSA-M
MW334.46 g/mol
LogP1.84
Rot. Bonds10

About sodium 4-undecan-3-ylbenzenesulfonate

sodium 4-undecan-3-ylbenzenesulfonate (PubChem CID 23707964) has the molecular formula C17H27NaO3S and a molecular weight of 334.46 g/mol. Its IUPAC name is sodium 4-undecan-3-ylbenzenesulfonate.

Molecular Properties

Compound Namesodium 4-undecan-3-ylbenzenesulfonate
PubChem CID23707964
Molecular FormulaC17H27NaO3S
Molecular Weight334.46 g/mol
Exact Mass334.16
IUPAC Namesodium 4-undecan-3-ylbenzenesulfonate
SMILESCCCCCCCCC(CC)c1ccc(S(=O)(=O)[O-])cc1.[Na+]
InChIInChI=1S/C17H28O3S.Na/c1-3-5-6-7-8-9-10-15(4-2)16-11-13-17(14-12-16)21(18,19)20;/h11-15H,3-10H2,1-2H3,(H,18,19,20);/q;+1/p-1
InChIKeyHUKUZKXWBQJYTO-UHFFFAOYSA-M
XLogP1.84
TPSA57.20 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds10
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500334.46
LogP ≤ 51.84
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze sodium 4-undecan-3-ylbenzenesulfonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

sodium 4-nonadecan-3-ylbenzenesulfonate
CID 164851691
sodium 4-tetradecan-3-ylbenzenesulfonate
CID 138394823
sodium 4-pentadecan-8-ylbenzenesulfonate
CID 100958990
sodium 4-octadecan-7-ylbenzenesulfonate
CID 101426973
sodium 4-docosan-11-ylbenzenesulfonate
CID 101217064
sodium 4-hexadecan-4-ylbenzenesulfonate
CID 164851731
4-decan-5-ylbenzenesulfonate
CID 140652920
sodium 4-decan-2-ylbenzenesulfonate
CID 23691725
sodium 4-dodec-11-en-6-ylbenzenesulfonate
CID 101371270
sodium 4-heptan-4-ylbenzenesulfonate
CID 164851730
4-dodecan-2-ylbenzenesulfonate;methane
CID 160695225
methyl 4-tridecan-7-ylbenzenesulfonate
CID 14299440

Frequently Asked Questions

What is the IUPAC name of sodium 4-undecan-3-ylbenzenesulfonate?
The IUPAC name of sodium 4-undecan-3-ylbenzenesulfonate (CID 23707964) is sodium 4-undecan-3-ylbenzenesulfonate.
What is the SMILES notation for sodium 4-undecan-3-ylbenzenesulfonate?
The canonical SMILES for sodium 4-undecan-3-ylbenzenesulfonate is CCCCCCCCC(CC)c1ccc(S(=O)(=O)[O-])cc1.[Na+].
What is the InChIKey of sodium 4-undecan-3-ylbenzenesulfonate?
The InChIKey is HUKUZKXWBQJYTO-UHFFFAOYSA-M. The full InChI is InChI=1S/C17H28O3S.Na/c1-3-5-6-7-8-9-10-15(4-2)16-11-13-17(14-12-16)21(18,19)20;/h11-15H,3-10H2,1-2H3,(H,18,19,20);/q;+1/p-1.
What are the key properties of sodium 4-undecan-3-ylbenzenesulfonate?
sodium 4-undecan-3-ylbenzenesulfonate has a molecular weight of 334.46 g/mol, XLogP of 1.84, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 4-undecan-3-ylbenzenesulfonate is sourced from PubChem (CID 23707964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).