About sodium;diacetyloxyalumanyl acetate;hydride
sodium;diacetyloxyalumanyl acetate;hydride (PubChem CID 23708319) has the molecular formula C6H10AlNaO6
and a molecular weight of 228.11 g/mol. Its IUPAC name is sodium;diacetyloxyalumanyl acetate;hydride.
Molecular Properties
| Compound Name | sodium;diacetyloxyalumanyl acetate;hydride |
| PubChem CID | 23708319 |
| Molecular Formula | C6H10AlNaO6 |
| Molecular Weight | 228.11 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | sodium;diacetyloxyalumanyl acetate;hydride |
| SMILES | CC(=O)O[Al](OC(C)=O)OC(C)=O.[H-].[Na+] |
| InChI | InChI=1S/3C2H4O2.Al.Na.H/c3*1-2(3)4;;;/h3*1H3,(H,3,4);;;/q;;;+3;+1;-1/p-3 |
| InChIKey | IANLSTQQTLEBHD-UHFFFAOYSA-K |
| XLogP | -3.22 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.11 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze sodium;diacetyloxyalumanyl acetate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;diacetyloxyalumanyl acetate;hydride?
The IUPAC name of sodium;diacetyloxyalumanyl acetate;hydride (CID 23708319) is sodium;diacetyloxyalumanyl acetate;hydride.
What is the SMILES notation for sodium;diacetyloxyalumanyl acetate;hydride?
The canonical SMILES for sodium;diacetyloxyalumanyl acetate;hydride is CC(=O)O[Al](OC(C)=O)OC(C)=O.[H-].[Na+].
What is the InChIKey of sodium;diacetyloxyalumanyl acetate;hydride?
The InChIKey is IANLSTQQTLEBHD-UHFFFAOYSA-K. The full InChI is InChI=1S/3C2H4O2.Al.Na.H/c3*1-2(3)4;;;/h3*1H3,(H,3,4);;;/q;;;+3;+1;-1/p-3.
What are the key properties of sodium;diacetyloxyalumanyl acetate;hydride?
sodium;diacetyloxyalumanyl acetate;hydride has a molecular weight of 228.11 g/mol, XLogP of -3.22, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;diacetyloxyalumanyl acetate;hydride is sourced from PubChem (CID 23708319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).