C8H10NNaO5 — CID 23708489
sodium 3-(2-hydroxyethyl)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 23708489) has the molecular formula C8H10NNaO5 and a molecular weight of 223.16 g/mol. Its IUPAC name is sodium 3-(2-hydroxyethyl)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | sodium 3-(2-hydroxyethyl)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 23708489 |
| Molecular Formula | C8H10NNaO5 |
| Molecular Weight | 223.16 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | sodium 3-(2-hydroxyethyl)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | O=C([O-])C1C(CCO)OC2CC(=O)N21.[Na+] |
| InChI | InChI=1S/C8H11NO5.Na/c10-2-1-4-7(8(12)13)9-5(11)3-6(9)14-4;/h4,6-7,10H,1-3H2,(H,12,13);/q;+1/p-1 |
| InChIKey | PQUVYNNZBUPCTJ-UHFFFAOYSA-M |
| XLogP | -5.55 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.16 |
| LogP ≤ 5 | -5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |