C12H4F9NaO2 — CID 23708701
sodium (Z)-1-(3,4-difluorophenyl)-4,4,5,5,6,6,6-heptafluoro-3-oxohex-1-en-1-olate (PubChem CID 23708701) has the molecular formula C12H4F9NaO2 and a molecular weight of 374.13 g/mol. Its IUPAC name is sodium (Z)-1-(3,4-difluorophenyl)-4,4,5,5,6,6,6-heptafluoro-3-oxohex-1-en-1-olate.
| Compound Name | sodium (Z)-1-(3,4-difluorophenyl)-4,4,5,5,6,6,6-heptafluoro-3-oxohex-1-en-1-olate |
|---|---|
| PubChem CID | 23708701 |
| Molecular Formula | C12H4F9NaO2 |
| Molecular Weight | 374.13 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | sodium (Z)-1-(3,4-difluorophenyl)-4,4,5,5,6,6,6-heptafluoro-3-oxohex-1-en-1-olate |
| SMILES | O=C(/C=C(\[O-])c1ccc(F)c(F)c1)C(F)(F)C(F)(F)C(F)(F)F.[Na+] |
| InChI | InChI=1S/C12H5F9O2.Na/c13-6-2-1-5(3-7(6)14)8(22)4-9(23)10(15,16)11(17,18)12(19,20)21;/h1-4,22H;/q;+1/p-1/b8-4-; |
| InChIKey | QMABEQATORPTCR-ZYFYRQFPSA-M |
| XLogP | 0.07 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.13 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|